C14H9ClN6O5 — CID 3097054
4-amino-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 3097054) has the molecular formula C14H9ClN6O5 and a molecular weight of 376.72 g/mol. Its IUPAC name is 4-amino-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 3097054 |
| Molecular Formula | C14H9ClN6O5 |
| Molecular Weight | 376.72 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-amino-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NN=Cc1ccc(-c2ccc(Cl)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C14H9ClN6O5/c15-9-3-1-7(5-10(9)21(23)24)11-4-2-8(25-11)6-17-18-14(22)12-13(16)20-26-19-12/h1-6H,(H2,16,20)(H,18,22) |
| InChIKey | CFFFEKIDJPYPFR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|