C21H12ClFN8O4 — CID 3149282
5-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 3149282) has the molecular formula C21H12ClFN8O4 and a molecular weight of 494.83 g/mol. Its IUPAC name is 5-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 3149282 |
| Molecular Formula | C21H12ClFN8O4 |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 5-N-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | O=[N+]([O-])c1cc(-c2ccc(C=NNc3nc4nonc4nc3Nc3ccc(F)cc3)o2)ccc1Cl |
| InChI | InChI=1S/C21H12ClFN8O4/c22-15-7-1-11(9-16(15)31(32)33)17-8-6-14(34-17)10-24-28-19-18(25-13-4-2-12(23)3-5-13)26-20-21(27-19)30-35-29-20/h1-10H,(H,25,26,29)(H,27,28,30) |
| InChIKey | JGNIZCBDGUWOEP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 157.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|