C24H21Cl2FN8O4 — CID 90484635
2-N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 90484635) has the molecular formula C24H21Cl2FN8O4 and a molecular weight of 575.39 g/mol. Its IUPAC name is 2-N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90484635 |
| Molecular Formula | C24H21Cl2FN8O4 |
| Molecular Weight | 575.39 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 2-N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(-c2ccc(/C=N\Nc3nc(Nc4ccc(F)cc4)nc(N4CCOCC4)n3)o2)ccc1Cl |
| InChI | InChI=1S/C24H20ClFN8O4.ClH/c25-19-7-1-15(13-20(19)34(35)36)21-8-6-18(38-21)14-27-32-23-29-22(28-17-4-2-16(26)3-5-17)30-24(31-23)33-9-11-37-12-10-33;/h1-8,13-14H,9-12H2,(H2,28,29,30,31,32);1H/b27-14-; |
| InChIKey | KYDSCBUXGXPVDD-JXTIHSCLSA-N |
| XLogP | 5.28 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|