C24H21N9O5 — CID 56698753
4-N-(4-nitrophenyl)-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 56698753) has the molecular formula C24H21N9O5 and a molecular weight of 515.49 g/mol. Its IUPAC name is 4-N-(4-nitrophenyl)-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(4-nitrophenyl)-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56698753 |
| Molecular Formula | C24H21N9O5 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 4-N-(4-nitrophenyl)-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(N/N=C/c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)nc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C24H21N9O5/c34-32(35)18-7-3-16(4-8-18)21-12-11-20(38-21)15-25-30-23-27-22(28-24(29-23)31-13-1-2-14-31)26-17-5-9-19(10-6-17)33(36)37/h3-12,15H,1-2,13-14H2,(H2,26,27,28,29,30)/b25-15+ |
| InChIKey | ZWNBIFZGIWSJIX-MFKUBSTISA-N |
| XLogP | 4.74 |
| TPSA | 177.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|