C22H19FN8O3 — CID 2860242
6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 2860242) has the molecular formula C22H19FN8O3 and a molecular weight of 462.45 g/mol. Its IUPAC name is 6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 2860242 |
| Molecular Formula | C22H19FN8O3 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(NN=Cc2ccc(-c3ccc([N+](=O)[O-])cc3)o2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H19FN8O3/c1-30(2)22-27-20(25-16-7-5-15(23)6-8-16)26-21(28-22)29-24-13-18-11-12-19(34-18)14-3-9-17(10-4-14)31(32)33/h3-13H,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | HNKSCYJXODLIRN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|