C28H22N8O6 — CID 22829046
3-[5-[(E)-[[4-(4-methoxyanilino)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 22829046) has the molecular formula C28H22N8O6 and a molecular weight of 566.53 g/mol. Its IUPAC name is 3-[5-[(E)-[[4-(4-methoxyanilino)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-[[4-(4-methoxyanilino)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 22829046 |
| Molecular Formula | C28H22N8O6 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 3-[5-[(E)-[[4-(4-methoxyanilino)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COc1ccc(Nc2nc(N/N=C/c3ccc(-c4cccc(C(=O)O)c4)o3)nc(Nc3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C28H22N8O6/c1-41-22-11-7-20(8-12-22)31-27-32-26(30-19-5-9-21(10-6-19)36(39)40)33-28(34-27)35-29-16-23-13-14-24(42-23)17-3-2-4-18(15-17)25(37)38/h2-16H,1H3,(H,37,38)(H3,30,31,32,33,34,35)/b29-16+ |
| InChIKey | NGCIOPOJCWACLV-MUFRIFMGSA-N |
| XLogP | 5.68 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|