C27H20ClFN8O4 — CID 4002300
2-N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylideneamino]-4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 4002300) has the molecular formula C27H20ClFN8O4 and a molecular weight of 574.96 g/mol. Its IUPAC name is 2-N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylideneamino]-4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylideneamino]-4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 4002300 |
| Molecular Formula | C27H20ClFN8O4 |
| Molecular Weight | 574.96 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 2-N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylideneamino]-4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(NN=Cc3ccc(-c4ccc(F)c(Cl)c4)o3)nc(Nc3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C27H20ClFN8O4/c1-40-20-9-5-18(6-10-20)32-26-33-25(31-17-3-7-19(8-4-17)37(38)39)34-27(35-26)36-30-15-21-11-13-24(41-21)16-2-12-23(29)22(28)14-16/h2-15H,1H3,(H3,31,32,33,34,35,36) |
| InChIKey | QUGIJHJJSWRBLT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.96 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|