C27H22N8O3 — CID 56691185
6-N-benzyl-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 56691185) has the molecular formula C27H22N8O3 and a molecular weight of 506.53 g/mol. Its IUPAC name is 6-N-benzyl-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-benzyl-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 56691185 |
| Molecular Formula | C27H22N8O3 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 6-N-benzyl-2-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(/C=N/Nc3nc(NCc4ccccc4)nc(Nc4ccccc4)n3)o2)cc1 |
| InChI | InChI=1S/C27H22N8O3/c36-35(37)22-13-11-20(12-14-22)24-16-15-23(38-24)18-29-34-27-32-25(28-17-19-7-3-1-4-8-19)31-26(33-27)30-21-9-5-2-6-10-21/h1-16,18H,17H2,(H3,28,30,31,32,33,34)/b29-18+ |
| InChIKey | SNTHCQNQJXZGNW-RDRPBHBLSA-N |
| XLogP | 5.84 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|