C23H21FN8O4 — CID 3111792
6-N-(4-fluorophenyl)-4-N-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 3111792) has the molecular formula C23H21FN8O4 and a molecular weight of 492.47 g/mol. Its IUPAC name is 6-N-(4-fluorophenyl)-4-N-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(4-fluorophenyl)-4-N-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3111792 |
| Molecular Formula | C23H21FN8O4 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 6-N-(4-fluorophenyl)-4-N-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(-c2ccc(C=NNc3nc(Nc4ccc(F)cc4)nc(N(C)C)n3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21FN8O4/c1-31(2)23-28-21(26-15-6-4-14(24)5-7-15)27-22(29-23)30-25-13-17-9-11-20(36-17)18-10-8-16(35-3)12-19(18)32(33)34/h4-13H,1-3H3,(H2,26,27,28,29,30) |
| InChIKey | IGFPVUZELVGBDS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|