C18H18FN7 — CID 4213211
4-N-(benzylideneamino)-6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 4213211) has the molecular formula C18H18FN7 and a molecular weight of 351.39 g/mol. Its IUPAC name is 4-N-(benzylideneamino)-6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(benzylideneamino)-6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 4213211 |
| Molecular Formula | C18H18FN7 |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-N-(benzylideneamino)-6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(NN=Cc2ccccc2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H18FN7/c1-26(2)18-23-16(21-15-10-8-14(19)9-11-15)22-17(24-18)25-20-12-13-6-4-3-5-7-13/h3-12H,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | ZTRGUTYNDAMQMV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|