C19H22ClN7 — CID 146051345
6-N-benzyl-4-N-[(E)-benzylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride (PubChem CID 146051345) has the molecular formula C19H22ClN7 and a molecular weight of 383.89 g/mol. Its IUPAC name is 6-N-benzyl-4-N-[(E)-benzylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride.
| Compound Name | 6-N-benzyl-4-N-[(E)-benzylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 146051345 |
| Molecular Formula | C19H22ClN7 |
| Molecular Weight | 383.89 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 6-N-benzyl-4-N-[(E)-benzylideneamino]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(N/N=C/c2ccccc2)n1.Cl |
| InChI | InChI=1S/C19H21N7.ClH/c1-26(2)19-23-17(20-13-15-9-5-3-6-10-15)22-18(24-19)25-21-14-16-11-7-4-8-12-16;/h3-12,14H,13H2,1-2H3,(H2,20,22,23,24,25);1H/b21-14+; |
| InChIKey | HDYQNJGGUNJTFT-UNLLECTCSA-N |
| XLogP | 3.42 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|