C24H21N7O2 — CID 56691085
2-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-N-benzyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 56691085) has the molecular formula C24H21N7O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-N-benzyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-N-benzyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 56691085 |
| Molecular Formula | C24H21N7O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-N-benzyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C(=N/Nc1nc(NCc2ccccc2)nc(Nc2ccccc2)n1)\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21N7O2/c1-3-7-17(8-4-1)14-25-22-28-23(27-19-9-5-2-6-10-19)30-24(29-22)31-26-15-18-11-12-20-21(13-18)33-16-32-20/h1-13,15H,14,16H2,(H3,25,27,28,29,30,31)/b26-15+ |
| InChIKey | PHOJTYFZFTUQJG-CVKSISIWSA-N |
| XLogP | 4.40 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|