C18H14N2O2 — CID 70582954
N-(1,3-benzodioxol-5-ylmethylideneamino)naphthalen-2-amine (PubChem CID 70582954) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)naphthalen-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)naphthalen-2-amine |
|---|---|
| PubChem CID | 70582954 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)naphthalen-2-amine |
| SMILES | C(=NNc1ccc2ccccc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N2O2/c1-2-4-15-10-16(7-6-14(15)3-1)20-19-11-13-5-8-17-18(9-13)22-12-21-17/h1-11,20H,12H2 |
| InChIKey | RTEUPCGBABIALX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|