C20H16NO3P — CID 10915051
(E)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylmethanimine (PubChem CID 10915051) has the molecular formula C20H16NO3P and a molecular weight of 349.33 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylmethanimine.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylmethanimine |
|---|---|
| PubChem CID | 10915051 |
| Molecular Formula | C20H16NO3P |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylmethanimine |
| SMILES | O=P(/N=C/c1ccc2c(c1)OCO2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16NO3P/c22-25(17-7-3-1-4-8-17,18-9-5-2-6-10-18)21-14-16-11-12-19-20(13-16)24-15-23-19/h1-14H,15H2/b21-14+ |
| InChIKey | YRHIKZFEFIEWOZ-KGENOOAVSA-N |
| XLogP | 3.76 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|