C20H17N2O2PS — CID 6902899
5-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-1,3-benzodioxole (PubChem CID 6902899) has the molecular formula C20H17N2O2PS and a molecular weight of 380.41 g/mol. Its IUPAC name is 5-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-1,3-benzodioxole.
| Compound Name | 5-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 6902899 |
| Molecular Formula | C20H17N2O2PS |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 5-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-1,3-benzodioxole |
| SMILES | S=P(N/N=C/c1ccc2c(c1)OCO2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17N2O2PS/c26-25(17-7-3-1-4-8-17,18-9-5-2-6-10-18)22-21-14-16-11-12-19-20(13-16)24-15-23-19/h1-14H,15H2,(H,22,26)/b21-14+ |
| InChIKey | HRPDNRYTNQKXDZ-KGENOOAVSA-N |
| XLogP | 3.38 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|