C24H20N2O3 — CID 6894206
(1S)-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 6894206) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is (1S)-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6894206 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (1S)-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C/c1ccc2c(c1)OCO2)[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O3/c27-23(26-25-15-17-11-12-21-22(13-17)29-16-28-21)20-14-24(20,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-13,15,20H,14,16H2,(H,26,27)/b25-15+/t20-/m1/s1 |
| InChIKey | AUJDAFPYGRENTR-PXMCARDJSA-N |
| XLogP | 3.87 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|