C30H24N2O3 — CID 3683774
[4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 3683774) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is [4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 3683774 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=O)C2CC2(c2ccccc2)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O3/c33-28(27-20-30(27,24-12-6-2-7-13-24)25-14-8-3-9-15-25)32-31-21-22-16-18-26(19-17-22)35-29(34)23-10-4-1-5-11-23/h1-19,21,27H,20H2,(H,32,33) |
| InChIKey | DTCOOFSXJIRQMM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|