C30H23N3O5 — CID 3954958
[3-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 3954958) has the molecular formula C30H23N3O5 and a molecular weight of 505.53 g/mol. Its IUPAC name is [3-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [3-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 3954958 |
| Molecular Formula | C30H23N3O5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | [3-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1cccc(C=NNC(=O)C2CC2(c2ccccc2)c2ccccc2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H23N3O5/c34-28(27-19-30(27,23-9-3-1-4-10-23)24-11-5-2-6-12-24)32-31-20-21-8-7-13-26(18-21)38-29(35)22-14-16-25(17-15-22)33(36)37/h1-18,20,27H,19H2,(H,32,34) |
| InChIKey | UACVTEXOYDZJKM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|