C32H28N2O5 — CID 4051908
[4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 4051908) has the molecular formula C32H28N2O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is [4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 4051908 |
| Molecular Formula | C32H28N2O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [4-[[(2,2-diphenylcyclopropanecarbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C=NNC(=O)C3CC3(c3ccccc3)c3ccccc3)cc2OC)c1 |
| InChI | InChI=1S/C32H28N2O5/c1-37-26-15-9-10-23(19-26)31(36)39-28-17-16-22(18-29(28)38-2)21-33-34-30(35)27-20-32(27,24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-19,21,27H,20H2,1-2H3,(H,34,35) |
| InChIKey | OAXJMOOQVQPBFU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|