C25H23N3O7 — CID 19659419
[2-methoxy-4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate (PubChem CID 19659419) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [2-methoxy-4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19659419 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [2-methoxy-4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C/c2ccc(OC(=O)c3cccc(OC)c3)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H23N3O7/c1-32-19-10-8-18(9-11-19)27-23(29)24(30)28-26-15-16-7-12-21(22(13-16)34-3)35-25(31)17-5-4-6-20(14-17)33-2/h4-15H,1-3H3,(H,27,29)(H,28,30)/b26-15+ |
| InChIKey | OHHKLPADUHXMLD-CVKSISIWSA-N |
| XLogP | 3.02 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|