C29H27N5O7 — CID 5236597
[4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 5236597) has the molecular formula C29H27N5O7 and a molecular weight of 557.56 g/mol. Its IUPAC name is [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 5236597 |
| Molecular Formula | C29H27N5O7 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C=NNC(=O)C(=O)Nc3c(C)n(C)n(-c4ccccc4)c3=O)cc2OC)c1 |
| InChI | InChI=1S/C29H27N5O7/c1-18-25(28(37)34(33(18)2)21-10-6-5-7-11-21)31-26(35)27(36)32-30-17-19-13-14-23(24(15-19)40-4)41-29(38)20-9-8-12-22(16-20)39-3/h5-17H,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | ZRWOXVQLPUCTLY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 142.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|