C29H28ClN5O5 — CID 3366034
N'-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide (PubChem CID 3366034) has the molecular formula C29H28ClN5O5 and a molecular weight of 562.03 g/mol. Its IUPAC name is N'-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide.
| Compound Name | N'-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 3366034 |
| Molecular Formula | C29H28ClN5O5 |
| Molecular Weight | 562.03 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | N'-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C29H28ClN5O5/c1-4-39-25-16-20(13-14-24(25)40-18-21-9-8-10-22(30)15-21)17-31-33-28(37)27(36)32-26-19(2)34(3)35(29(26)38)23-11-6-5-7-12-23/h5-17H,4,18H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | VUNXHYFQQZAINM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.03 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|