C28H24ClN5O6 — CID 4129697
[4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 4129697) has the molecular formula C28H24ClN5O6 and a molecular weight of 561.98 g/mol. Its IUPAC name is [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4129697 |
| Molecular Formula | C28H24ClN5O6 |
| Molecular Weight | 561.98 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H24ClN5O6/c1-17-24(27(37)34(33(17)2)21-7-5-4-6-8-21)31-25(35)26(36)32-30-16-18-9-14-22(23(15-18)39-3)40-28(38)19-10-12-20(29)13-11-19/h4-16H,1-3H3,(H,31,35)(H,32,36) |
| InChIKey | ZSUIEBSJQIICPG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.98 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|