C28H25N5O6 — CID 4160044
[4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] benzoate (PubChem CID 4160044) has the molecular formula C28H25N5O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 4160044 |
| Molecular Formula | C28H25N5O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [4-[[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H25N5O6/c1-18-24(27(36)33(32(18)2)21-12-8-5-9-13-21)30-25(34)26(35)31-29-17-19-14-15-22(23(16-19)38-3)39-28(37)20-10-6-4-7-11-20/h4-17H,1-3H3,(H,30,34)(H,31,35) |
| InChIKey | BWLDHVPHCGKTLB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|