C22H24N6O4S — CID 168535793
2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide (PubChem CID 168535793) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide.
| Compound Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 168535793 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
| SMILES | COc1cc(C=NNC(N)=S)ccc1OCC(=O)Nc1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H24N6O4S/c1-14-20(21(30)28(27(14)2)16-7-5-4-6-8-16)25-19(29)13-32-17-10-9-15(11-18(17)31-3)12-24-26-22(23)33/h4-12H,13H2,1-3H3,(H,25,29)(H3,23,26,33) |
| InChIKey | LTPWLRKTNAFTFA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|