C11H14N4O3S — CID 57363037
2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]acetamide (PubChem CID 57363037) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 57363037 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C=NNC(N)=S)ccc1OCC(N)=O |
| InChI | InChI=1S/C11H14N4O3S/c1-17-9-4-7(5-14-15-11(13)19)2-3-8(9)18-6-10(12)16/h2-5H,6H2,1H3,(H2,12,16)(H3,13,15,19) |
| InChIKey | ZDMSFIPVLLGEGH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|