C11H13BrN4O3S — CID 57363032
2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenoxy]acetamide (PubChem CID 57363032) has the molecular formula C11H13BrN4O3S and a molecular weight of 361.22 g/mol. Its IUPAC name is 2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 57363032 |
| Molecular Formula | C11H13BrN4O3S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C=NNC(N)=S)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C11H13BrN4O3S/c1-18-8-3-6(4-15-16-11(14)20)2-7(12)10(8)19-5-9(13)17/h2-4H,5H2,1H3,(H2,13,17)(H3,14,16,20) |
| InChIKey | NBTGBIWECGJDNY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|