C12H14ClN3O4S — CID 6150314
methyl 2-[4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-chloro-6-methoxyphenoxy]acetate (PubChem CID 6150314) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-chloro-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-chloro-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 6150314 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | methyl 2-[4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-chloro-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(/C=N\NC(N)=S)cc1OC |
| InChI | InChI=1S/C12H14ClN3O4S/c1-18-9-4-7(5-15-16-12(14)21)3-8(13)11(9)20-6-10(17)19-2/h3-5H,6H2,1-2H3,(H3,14,16,21)/b15-5- |
| InChIKey | DXTVCWYJZBLEBJ-WCSRMQSCSA-N |
| XLogP | 1.07 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|