C12H16ClN3O2S — CID 19617933
[(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]thiourea (PubChem CID 19617933) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is [(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]thiourea.
| Compound Name | [(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 19617933 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | [(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]thiourea |
| SMILES | CCCOc1c(Cl)cc(/C=N/NC(N)=S)cc1OC |
| InChI | InChI=1S/C12H16ClN3O2S/c1-3-4-18-11-9(13)5-8(6-10(11)17-2)7-15-16-12(14)19/h5-7H,3-4H2,1-2H3,(H3,14,16,19)/b15-7+ |
| InChIKey | RSPYDYGCYAXEKZ-VIZOYTHASA-N |
| XLogP | 2.30 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|