C11H14ClN3O2S — CID 19617965
[(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]thiourea (PubChem CID 19617965) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is [(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | [(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 19617965 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]thiourea |
| SMILES | CCOc1cc(/C=N/NC(N)=S)cc(Cl)c1OC |
| InChI | InChI=1S/C11H14ClN3O2S/c1-3-17-9-5-7(6-14-15-11(13)18)4-8(12)10(9)16-2/h4-6H,3H2,1-2H3,(H3,13,15,18)/b14-6+ |
| InChIKey | GITDFNMYWPRFHT-MKMNVTDBSA-N |
| XLogP | 1.91 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|