C18H18BrN3O4 — CID 5431292
N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide (PubChem CID 5431292) has the molecular formula C18H18BrN3O4 and a molecular weight of 420.26 g/mol. Its IUPAC name is N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide.
| Compound Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 5431292 |
| Molecular Formula | C18H18BrN3O4 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(4-bromophenyl)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2ccc(Br)cc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C18H18BrN3O4/c1-25-16-8-13(4-7-15(16)26-11-17(20)23)10-21-22-18(24)9-12-2-5-14(19)6-3-12/h2-8,10H,9,11H2,1H3,(H2,20,23)(H,22,24)/b21-10- |
| InChIKey | YNPRLUSLUZIMRK-FBHDLOMBSA-N |
| XLogP | 2.01 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|