C18H20N4O4S — CID 7965917
2-[2-methoxy-4-[(Z)-[(3-methoxyphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 7965917) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[(3-methoxyphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-4-[(Z)-[(3-methoxyphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 7965917 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[(3-methoxyphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cccc(NC(=S)N/N=C\c2ccc(OCC(N)=O)c(OC)c2)c1 |
| InChI | InChI=1S/C18H20N4O4S/c1-24-14-5-3-4-13(9-14)21-18(27)22-20-10-12-6-7-15(16(8-12)25-2)26-11-17(19)23/h3-10H,11H2,1-2H3,(H2,19,23)(H2,21,22,27)/b20-10- |
| InChIKey | UCJXPEKCOLVTTF-JMIUGGIZSA-N |
| XLogP | 1.89 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|