C19H21N3O5S — CID 9216189
[4-[(Z)-[(3,4-dimethoxyphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 9216189) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is [4-[(Z)-[(3,4-dimethoxyphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[(3,4-dimethoxyphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 9216189 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [4-[(Z)-[(3,4-dimethoxyphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1ccc(NC(=S)N/N=C\c2ccc(OC(C)=O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H21N3O5S/c1-12(23)27-16-7-5-13(9-17(16)25-3)11-20-22-19(28)21-14-6-8-15(24-2)18(10-14)26-4/h5-11H,1-4H3,(H2,21,22,28)/b20-11- |
| InChIKey | VENZMSYMGLMYKP-JAIQZWGSSA-N |
| XLogP | 2.96 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|