C17H17F2N3O3S — CID 6255067
1-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 6255067) has the molecular formula C17H17F2N3O3S and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 6255067 |
| Molecular Formula | C17H17F2N3O3S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C\c2ccc(OC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C17H17F2N3O3S/c1-23-14-8-5-12(9-15(14)24-2)21-17(26)22-20-10-11-3-6-13(7-4-11)25-16(18)19/h3-10,16H,1-2H3,(H2,21,22,26)/b20-10- |
| InChIKey | VDGRWAWWGWQAQB-JMIUGGIZSA-N |
| XLogP | 3.63 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|