C18H19F2N3O4S — CID 9256473
1-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-3-(3-methoxyphenyl)thiourea (PubChem CID 9256473) has the molecular formula C18H19F2N3O4S and a molecular weight of 411.43 g/mol. Its IUPAC name is 1-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 9256473 |
| Molecular Formula | C18H19F2N3O4S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N/N=C\c2cc(OC)c(OC(F)F)c(OC)c2)c1 |
| InChI | InChI=1S/C18H19F2N3O4S/c1-24-13-6-4-5-12(9-13)22-18(28)23-21-10-11-7-14(25-2)16(27-17(19)20)15(8-11)26-3/h4-10,17H,1-3H3,(H2,22,23,28)/b21-10- |
| InChIKey | UDEWZMAWDJRCNA-FBHDLOMBSA-N |
| XLogP | 3.63 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|