C15H14FN3OS — CID 7966012
1-[(Z)-(3-fluorophenyl)methylideneamino]-3-(3-methoxyphenyl)thiourea (PubChem CID 7966012) has the molecular formula C15H14FN3OS and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[(Z)-(3-fluorophenyl)methylideneamino]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(Z)-(3-fluorophenyl)methylideneamino]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 7966012 |
| Molecular Formula | C15H14FN3OS |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-[(Z)-(3-fluorophenyl)methylideneamino]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N/N=C\c2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H14FN3OS/c1-20-14-7-3-6-13(9-14)18-15(21)19-17-10-11-4-2-5-12(16)8-11/h2-10H,1H3,(H2,18,19,21)/b17-10- |
| InChIKey | LFAPHNIVYJOTEP-YVLHZVERSA-N |
| XLogP | 3.15 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|