C23H20F4N4O3S2 — CID 4158492
1-[4-(difluoromethoxy)phenyl]-3-[3-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4-methoxyphenyl]thiourea (PubChem CID 4158492) has the molecular formula C23H20F4N4O3S2 and a molecular weight of 540.56 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[3-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4-methoxyphenyl]thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[3-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4-methoxyphenyl]thiourea |
|---|---|
| PubChem CID | 4158492 |
| Molecular Formula | C23H20F4N4O3S2 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[3-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4-methoxyphenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(OC(F)F)cc2)cc1NC(=S)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H20F4N4O3S2/c1-32-19-11-6-15(30-22(35)28-13-2-7-16(8-3-13)33-20(24)25)12-18(19)31-23(36)29-14-4-9-17(10-5-14)34-21(26)27/h2-12,20-21H,1H3,(H2,28,30,35)(H2,29,31,36) |
| InChIKey | WXNHWYVWGCWKSK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|