C14H15N3O2S — CID 19655598
1-(2,5-dimethoxyphenyl)-3-pyridin-4-ylthiourea (PubChem CID 19655598) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-pyridin-4-ylthiourea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-pyridin-4-ylthiourea |
|---|---|
| PubChem CID | 19655598 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-pyridin-4-ylthiourea |
| SMILES | COc1ccc(OC)c(NC(=S)Nc2ccncc2)c1 |
| InChI | InChI=1S/C14H15N3O2S/c1-18-11-3-4-13(19-2)12(9-11)17-14(20)16-10-5-7-15-8-6-10/h3-9H,1-2H3,(H2,15,16,17,20) |
| InChIKey | DBHOBQDCOZSEPX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|