C11H15N3O4S — CID 970721
methyl N-[(2,5-dimethoxyphenyl)carbamothioylamino]carbamate (PubChem CID 970721) has the molecular formula C11H15N3O4S and a molecular weight of 285.33 g/mol. Its IUPAC name is methyl N-[(2,5-dimethoxyphenyl)carbamothioylamino]carbamate.
| Compound Name | methyl N-[(2,5-dimethoxyphenyl)carbamothioylamino]carbamate |
|---|---|
| PubChem CID | 970721 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl N-[(2,5-dimethoxyphenyl)carbamothioylamino]carbamate |
| SMILES | COC(=O)NNC(=S)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H15N3O4S/c1-16-7-4-5-9(17-2)8(6-7)12-10(19)13-14-11(15)18-3/h4-6H,1-3H3,(H,14,15)(H2,12,13,19) |
| InChIKey | HGOIGIRHMZDEGJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|