C15H15NO4S — CID 88825166
O-(4-hydroxyphenyl) N-(2,5-dimethoxyphenyl)carbamothioate (PubChem CID 88825166) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is O-(4-hydroxyphenyl) N-(2,5-dimethoxyphenyl)carbamothioate.
| Compound Name | O-(4-hydroxyphenyl) N-(2,5-dimethoxyphenyl)carbamothioate |
|---|---|
| PubChem CID | 88825166 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | O-(4-hydroxyphenyl) N-(2,5-dimethoxyphenyl)carbamothioate |
| SMILES | COc1ccc(OC)c(NC(=S)Oc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C15H15NO4S/c1-18-12-7-8-14(19-2)13(9-12)16-15(21)20-11-5-3-10(17)4-6-11/h3-9,17H,1-2H3,(H,16,21) |
| InChIKey | BFXKHZDOAXIYQR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|