C14H19NO5 — CID 174759761
tert-butyl 2-(2,5-dimethoxyanilino)-2-oxoacetate (PubChem CID 174759761) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is tert-butyl 2-(2,5-dimethoxyanilino)-2-oxoacetate.
| Compound Name | tert-butyl 2-(2,5-dimethoxyanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 174759761 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | tert-butyl 2-(2,5-dimethoxyanilino)-2-oxoacetate |
| SMILES | COc1ccc(OC)c(NC(=O)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H19NO5/c1-14(2,3)20-13(17)12(16)15-10-8-9(18-4)6-7-11(10)19-5/h6-8H,1-5H3,(H,15,16) |
| InChIKey | VFTZTFYSMZECHP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|