C14H18O5 — CID 102421540
tert-butyl 2-(2,4-dimethoxyphenyl)-2-oxoacetate (PubChem CID 102421540) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is tert-butyl 2-(2,4-dimethoxyphenyl)-2-oxoacetate.
| Compound Name | tert-butyl 2-(2,4-dimethoxyphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 102421540 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | tert-butyl 2-(2,4-dimethoxyphenyl)-2-oxoacetate |
| SMILES | COc1ccc(C(=O)C(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H18O5/c1-14(2,3)19-13(16)12(15)10-7-6-9(17-4)8-11(10)18-5/h6-8H,1-5H3 |
| InChIKey | ZGXLSWQGMDBFLK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|