C9H9O4- — CID 6947027
2,4-dimethoxybenzoate (PubChem CID 6947027) has the molecular formula C9H9O4- and a molecular weight of 181.17 g/mol. Its IUPAC name is 2,4-dimethoxybenzoate.
| Compound Name | 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 6947027 |
| Molecular Formula | C9H9O4- |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C9H10O4/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3,(H,10,11)/p-1 |
| InChIKey | GPVDHNVGGIAOQT-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |