C16H15O4- — CID 86307310
3-(2,4-dimethoxyphenyl)-2-methylbenzoate (PubChem CID 86307310) has the molecular formula C16H15O4- and a molecular weight of 271.29 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-2-methylbenzoate.
| Compound Name | 3-(2,4-dimethoxyphenyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 86307310 |
| Molecular Formula | C16H15O4- |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-2-methylbenzoate |
| SMILES | COc1ccc(-c2cccc(C(=O)[O-])c2C)c(OC)c1 |
| InChI | InChI=1S/C16H16O4/c1-10-12(5-4-6-13(10)16(17)18)14-8-7-11(19-2)9-15(14)20-3/h4-9H,1-3H3,(H,17,18)/p-1 |
| InChIKey | ZLKBRRAHIAWGQY-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |