C19H18O9 — CID 171476388
(2,4-dimethoxybenzoyl)oxycarbonyl 2,4-dimethoxybenzoate (PubChem CID 171476388) has the molecular formula C19H18O9 and a molecular weight of 390.34 g/mol. Its IUPAC name is (2,4-dimethoxybenzoyl)oxycarbonyl 2,4-dimethoxybenzoate.
| Compound Name | (2,4-dimethoxybenzoyl)oxycarbonyl 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 171476388 |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2,4-dimethoxybenzoyl)oxycarbonyl 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(=O)OC(=O)c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C19H18O9/c1-23-11-5-7-13(15(9-11)25-3)17(20)27-19(22)28-18(21)14-8-6-12(24-2)10-16(14)26-4/h5-10H,1-4H3 |
| InChIKey | PZRJBFKQYFCUOG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|