C22H24O8S — CID 15869444
[(3S,4R)-4-(2,4-dimethoxybenzoyl)oxythiolan-3-yl] 2,4-dimethoxybenzoate (PubChem CID 15869444) has the molecular formula C22H24O8S and a molecular weight of 448.49 g/mol. Its IUPAC name is [(3S,4R)-4-(2,4-dimethoxybenzoyl)oxythiolan-3-yl] 2,4-dimethoxybenzoate.
| Compound Name | [(3S,4R)-4-(2,4-dimethoxybenzoyl)oxythiolan-3-yl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 15869444 |
| Molecular Formula | C22H24O8S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(3S,4R)-4-(2,4-dimethoxybenzoyl)oxythiolan-3-yl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2CSC[C@H]2OC(=O)c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C22H24O8S/c1-25-13-5-7-15(17(9-13)27-3)21(23)29-19-11-31-12-20(19)30-22(24)16-8-6-14(26-2)10-18(16)28-4/h5-10,19-20H,11-12H2,1-4H3/t19-,20+ |
| InChIKey | MBAWELPJOHKKEX-BGYRXZFFSA-N |
| XLogP | 3.22 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |