C15H13BrO4 — CID 47098117
(4-bromophenyl) 2,4-dimethoxybenzoate (PubChem CID 47098117) has the molecular formula C15H13BrO4 and a molecular weight of 337.17 g/mol. Its IUPAC name is (4-bromophenyl) 2,4-dimethoxybenzoate.
| Compound Name | (4-bromophenyl) 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 47098117 |
| Molecular Formula | C15H13BrO4 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (4-bromophenyl) 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C15H13BrO4/c1-18-12-7-8-13(14(9-12)19-2)15(17)20-11-5-3-10(16)4-6-11/h3-9H,1-2H3 |
| InChIKey | QBLGTNBGRXNYHF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|