C23H20O8 — CID 134322443
1-O-(4-methoxyphenyl) 4-O-(4-methylperoxyphenyl) 2-methoxybenzene-1,4-dicarboxylate (PubChem CID 134322443) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is 1-O-(4-methoxyphenyl) 4-O-(4-methylperoxyphenyl) 2-methoxybenzene-1,4-dicarboxylate.
| Compound Name | 1-O-(4-methoxyphenyl) 4-O-(4-methylperoxyphenyl) 2-methoxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134322443 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-O-(4-methoxyphenyl) 4-O-(4-methylperoxyphenyl) 2-methoxybenzene-1,4-dicarboxylate |
| SMILES | COOc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(OC)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H20O8/c1-26-16-5-7-18(8-6-16)30-23(25)20-13-4-15(14-21(20)27-2)22(24)29-17-9-11-19(12-10-17)31-28-3/h4-14H,1-3H3 |
| InChIKey | BPEPFYOSTHIJSS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|