C21H14I2O5 — CID 71516815
bis(4-iodophenyl) 4-methoxybenzene-1,3-dicarboxylate (PubChem CID 71516815) has the molecular formula C21H14I2O5 and a molecular weight of 600.15 g/mol. Its IUPAC name is bis(4-iodophenyl) 4-methoxybenzene-1,3-dicarboxylate.
| Compound Name | bis(4-iodophenyl) 4-methoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71516815 |
| Molecular Formula | C21H14I2O5 |
| Molecular Weight | 600.15 g/mol |
| Exact Mass | 599.89 |
| IUPAC Name | bis(4-iodophenyl) 4-methoxybenzene-1,3-dicarboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc(I)cc2)cc1C(=O)Oc1ccc(I)cc1 |
| InChI | InChI=1S/C21H14I2O5/c1-26-19-11-2-13(20(24)27-16-7-3-14(22)4-8-16)12-18(19)21(25)28-17-9-5-15(23)6-10-17/h2-12H,1H3 |
| InChIKey | BAQGEEBPRWXVNJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.15 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|