C50H42I4O10 — CID 100918018
bis(4-iodophenyl) 2-[10-[2,5-bis[(4-iodophenoxy)carbonyl]phenoxy]decoxy]benzene-1,4-dicarboxylate (PubChem CID 100918018) has the molecular formula C50H42I4O10 and a molecular weight of 1310.49 g/mol. Its IUPAC name is bis(4-iodophenyl) 2-[10-[2,5-bis[(4-iodophenoxy)carbonyl]phenoxy]decoxy]benzene-1,4-dicarboxylate.
| Compound Name | bis(4-iodophenyl) 2-[10-[2,5-bis[(4-iodophenoxy)carbonyl]phenoxy]decoxy]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 100918018 |
| Molecular Formula | C50H42I4O10 |
| Molecular Weight | 1310.49 g/mol |
| Exact Mass | 1309.90 |
| IUPAC Name | bis(4-iodophenyl) 2-[10-[2,5-bis[(4-iodophenoxy)carbonyl]phenoxy]decoxy]benzene-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccc(I)cc1)c1ccc(C(=O)Oc2ccc(I)cc2)c(OCCCCCCCCCCOc2cc(C(=O)Oc3ccc(I)cc3)ccc2C(=O)Oc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C50H42I4O10/c51-35-11-19-39(20-12-35)61-47(55)33-9-27-43(49(57)63-41-23-15-37(53)16-24-41)45(31-33)59-29-7-5-3-1-2-4-6-8-30-60-46-32-34(48(56)62-40-21-13-36(52)14-22-40)10-28-44(46)50(58)64-42-25-17-38(54)18-26-42/h9-28,31-32H,1-8,29-30H2 |
| InChIKey | NZWZRNWSBZIZEF-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1310.49 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|